C10H13N — CID 159248655
(5R)-5-methyl-3,4,5,6-tetrahydroquinoline (PubChem CID 159248655) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (5R)-5-methyl-3,4,5,6-tetrahydroquinoline.
| Compound Name | (5R)-5-methyl-3,4,5,6-tetrahydroquinoline |
|---|---|
| PubChem CID | 159248655 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (5R)-5-methyl-3,4,5,6-tetrahydroquinoline |
| SMILES | C[C@@H]1CC=CC2=C1CCC=N2 |
| InChI | InChI=1S/C10H13N/c1-8-4-2-6-10-9(8)5-3-7-11-10/h2,6-8H,3-5H2,1H3/t8-/m1/s1 |
| InChIKey | KUZSKHGDBLVQNY-MRVPVSSYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |