C9H8NRb — CID 58202807
4,6-dihydro-3H-quinolin-6-ide;rubidium(1+) (PubChem CID 58202807) has the molecular formula C9H8NRb and a molecular weight of 215.64 g/mol. Its IUPAC name is 4,6-dihydro-3H-quinolin-6-ide;rubidium(1+).
| Compound Name | 4,6-dihydro-3H-quinolin-6-ide;rubidium(1+) |
|---|---|
| PubChem CID | 58202807 |
| Molecular Formula | C9H8NRb |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 214.98 |
| IUPAC Name | 4,6-dihydro-3H-quinolin-6-ide;rubidium(1+) |
| SMILES | [Rb+].[c-]1ccc2c(c1)CCC=N2 |
| InChI | InChI=1S/C9H8N.Rb/c1-2-6-9-8(4-1)5-3-7-10-9;/h2,4,6-7H,3,5H2;/q-1;+1 |
| InChIKey | DSKLFCUTKKEELH-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|