About diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole
diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole (PubChem CID 159260544) has the molecular formula C31H40N2O2Si
and a molecular weight of 500.76 g/mol. Its IUPAC name is diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole.
Molecular Properties
| Compound Name | diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole |
| PubChem CID | 159260544 |
| Molecular Formula | C31H40N2O2Si |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole |
| SMILES | CC.CC[Si](O)(CC)c1cc2ccccc2n1C.COc1ccc(-c2cc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C16H15NO.C13H19NOSi.C2H6/c1-17-15-6-4-3-5-13(15)11-16(17)12-7-9-14(18-2)10-8-12;1-4-16(15,5-2)13-10-11-8-6-7-9-12(11)14(13)3;1-2/h3-11H,1-2H3;6-10,15H,4-5H2,1-3H3;1-2H3 |
| InChIKey | KWLKVRNYACLGGV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 39.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole?
The IUPAC name of diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole (CID 159260544) is diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole.
What is the SMILES notation for diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole?
The canonical SMILES for diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole is CC.CC[Si](O)(CC)c1cc2ccccc2n1C.COc1ccc(-c2cc3ccccc3n2C)cc1.
What is the InChIKey of diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole?
The InChIKey is KWLKVRNYACLGGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO.C13H19NOSi.C2H6/c1-17-15-6-4-3-5-13(15)11-16(17)12-7-9-14(18-2)10-8-12;1-4-16(15,5-2)13-10-11-8-6-7-9-12(11)14(13)3;1-2/h3-11H,1-2H3;6-10,15H,4-5H2,1-3H3;1-2H3.
What are the key properties of diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole?
diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole has a molecular weight of 500.76 g/mol, XLogP of 7.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-hydroxy-(1-methylindol-2-yl)silane;ethane;2-(4-methoxyphenyl)-1-methylindole is sourced from PubChem (CID 159260544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).