C19H25ClN6O9P2 — CID 159266311
[[(2R,3S,4R,5R)-5-[5-chloro-7-[methyl-[(3-methylphenyl)methyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 159266311) has the molecular formula C19H25ClN6O9P2 and a molecular weight of 578.84 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[5-chloro-7-[methyl-[(3-methylphenyl)methyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[5-chloro-7-[methyl-[(3-methylphenyl)methyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 159266311 |
| Molecular Formula | C19H25ClN6O9P2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[5-chloro-7-[methyl-[(3-methylphenyl)methyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Cc1cccc(CN(C)c2nc(Cl)nc3c2nnn3[C@@H]2O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C19H25ClN6O9P2/c1-10-4-3-5-11(6-10)7-25(2)16-13-17(22-19(20)21-16)26(24-23-13)18-15(28)14(27)12(35-18)8-34-37(32,33)9-36(29,30)31/h3-6,12,14-15,18,27-28H,7-9H2,1-2H3,(H,32,33)(H2,29,30,31)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | GOYPJMSUITUQNU-SCFUHWHPSA-N |
| XLogP | 0.78 |
| TPSA | 213.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|