C22H31N3O7 — CID 159276877
N-[5-[(2R)-2-aminopentyl]-2-hydroxyphenyl]-3-[2-[2-(prop-2-ynoylamino)ethoxy]ethoxy]propanamide;carbon dioxide (PubChem CID 159276877) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is N-[5-[(2R)-2-aminopentyl]-2-hydroxyphenyl]-3-[2-[2-(prop-2-ynoylamino)ethoxy]ethoxy]propanamide;carbon dioxide.
| Compound Name | N-[5-[(2R)-2-aminopentyl]-2-hydroxyphenyl]-3-[2-[2-(prop-2-ynoylamino)ethoxy]ethoxy]propanamide;carbon dioxide |
|---|---|
| PubChem CID | 159276877 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[5-[(2R)-2-aminopentyl]-2-hydroxyphenyl]-3-[2-[2-(prop-2-ynoylamino)ethoxy]ethoxy]propanamide;carbon dioxide |
| SMILES | C#CC(=O)NCCOCCOCCC(=O)Nc1cc(C[C@H](N)CCC)ccc1O.O=C=O |
| InChI | InChI=1S/C21H31N3O5.CO2/c1-3-5-17(22)14-16-6-7-19(25)18(15-16)24-21(27)8-10-28-12-13-29-11-9-23-20(26)4-2;2-1-3/h2,6-7,15,17,25H,3,5,8-14,22H2,1H3,(H,23,26)(H,24,27);/t17-;/m1./s1 |
| InChIKey | KYKOCHPSVSFYHH-UNTBIKODSA-N |
| XLogP | 0.59 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|