C31H51IN2O11 — CID 59841678
6-[3-(4-hydroxy-3-(123I)iodophenyl)propanoylamino]-2-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid (PubChem CID 59841678) has the molecular formula C31H51IN2O11 and a molecular weight of 750.66 g/mol. Its IUPAC name is 6-[3-(4-hydroxy-3-(123I)iodophenyl)propanoylamino]-2-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | 6-[3-(4-hydroxy-3-(123I)iodophenyl)propanoylamino]-2-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 59841678 |
| Molecular Formula | C31H51IN2O11 |
| Molecular Weight | 750.66 g/mol |
| Exact Mass | 750.25 |
| IUPAC Name | 6-[3-(4-hydroxy-3-(123I)iodophenyl)propanoylamino]-2-[3-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]hexanoic acid |
| SMILES | CCCOCCOCCOCCOCCOCCOCCC(=O)NC(CCCCNC(=O)CCc1ccc(O)c([123I])c1)C(=O)O |
| InChI | InChI=1S/C31H51IN2O11/c1-2-12-40-14-16-42-18-20-44-22-23-45-21-19-43-17-15-41-13-10-30(37)34-27(31(38)39)5-3-4-11-33-29(36)9-7-25-6-8-28(35)26(32)24-25/h6,8,24,27,35H,2-5,7,9-23H2,1H3,(H,33,36)(H,34,37)(H,38,39)/i32-4 |
| InChIKey | BGLPJISMJWWNHO-UWESFZKISA-N |
| XLogP | 2.68 |
| TPSA | 171.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|