C24H51+ — CID 159285592
2,4,6-trimethylnonane;2,4,6-trimethylnonane (PubChem CID 159285592) has the molecular formula C24H51+ and a molecular weight of 339.67 g/mol. Its IUPAC name is 2,4,6-trimethylnonane;2,4,6-trimethylnonane.
| Compound Name | 2,4,6-trimethylnonane;2,4,6-trimethylnonane |
|---|---|
| PubChem CID | 159285592 |
| Molecular Formula | C24H51+ |
| Molecular Weight | 339.67 g/mol |
| Exact Mass | 339.40 |
| IUPAC Name | 2,4,6-trimethylnonane;2,4,6-trimethylnonane |
| SMILES | CCCC(C)CC(C)CC(C)C.C[CH+]CC(C)CC(C)CC(C)C |
| InChI | InChI=1S/C12H26.C12H25/c2*1-6-7-11(4)9-12(5)8-10(2)3/h10-12H,6-9H2,1-5H3;6,10-12H,7-9H2,1-5H3/q;+1 |
| InChIKey | KZLVXFPKSQGWFE-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.67 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|