About dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid
dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid (PubChem CID 159291449) has the molecular formula C18H40O7P2
and a molecular weight of 430.46 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid.
Molecular Properties
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid |
| PubChem CID | 159291449 |
| Molecular Formula | C18H40O7P2 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.OP(O)OP(O)O |
| InChI | InChI=1S/C18H36O2.H4O5P2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6(2)5-7(3)4/h2-17H2,1H3,(H,19,20);1-4H |
| InChIKey | LAEIFMYGINUFNO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid?
The IUPAC name of dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid (CID 159291449) is dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid.
What is the SMILES notation for dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid?
The canonical SMILES for dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.OP(O)OP(O)O.
What is the InChIKey of dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid?
The InChIKey is LAEIFMYGINUFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.H4O5P2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-6(2)5-7(3)4/h2-17H2,1H3,(H,19,20);1-4H.
What are the key properties of dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid?
dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid has a molecular weight of 430.46 g/mol, XLogP of 5.76, 18 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxyphosphanyl dihydrogen phosphite;octadecanoic acid is sourced from PubChem (CID 159291449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).