C30H38N2O4 — CID 159295522
4,6-diethyl-7-(ethylamino)chromen-2-one;7-(dimethylamino)-4,6-diethylchromen-2-one (PubChem CID 159295522) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is 4,6-diethyl-7-(ethylamino)chromen-2-one;7-(dimethylamino)-4,6-diethylchromen-2-one.
| Compound Name | 4,6-diethyl-7-(ethylamino)chromen-2-one;7-(dimethylamino)-4,6-diethylchromen-2-one |
|---|---|
| PubChem CID | 159295522 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 4,6-diethyl-7-(ethylamino)chromen-2-one;7-(dimethylamino)-4,6-diethylchromen-2-one |
| SMILES | CCNc1cc2oc(=O)cc(CC)c2cc1CC.CCc1cc2c(CC)cc(=O)oc2cc1N(C)C |
| InChI | InChI=1S/2C15H19NO2/c1-5-10-8-15(17)18-14-9-13(16(3)4)11(6-2)7-12(10)14;1-4-10-8-15(17)18-14-9-13(16-6-3)11(5-2)7-12(10)14/h7-9H,5-6H2,1-4H3;7-9,16H,4-6H2,1-3H3 |
| InChIKey | LAQYWJVNQRJZDX-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|