C18H23NO4 — CID 124883071
(2R)-2-(4-ethyl-2-oxochromen-7-yl)oxy-N,N,3-trimethylbutanamide (PubChem CID 124883071) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2R)-2-(4-ethyl-2-oxochromen-7-yl)oxy-N,N,3-trimethylbutanamide.
| Compound Name | (2R)-2-(4-ethyl-2-oxochromen-7-yl)oxy-N,N,3-trimethylbutanamide |
|---|---|
| PubChem CID | 124883071 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2R)-2-(4-ethyl-2-oxochromen-7-yl)oxy-N,N,3-trimethylbutanamide |
| SMILES | CCc1cc(=O)oc2cc(O[C@@H](C(=O)N(C)C)C(C)C)ccc12 |
| InChI | InChI=1S/C18H23NO4/c1-6-12-9-16(20)23-15-10-13(7-8-14(12)15)22-17(11(2)3)18(21)19(4)5/h7-11,17H,6H2,1-5H3/t17-/m1/s1 |
| InChIKey | RAVUAUIOEMDKEJ-QGZVFWFLSA-N |
| XLogP | 2.85 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|