C22H21N3O2 — CID 159306647
7-[2-(2-aminophenyl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one (PubChem CID 159306647) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 7-[2-(2-aminophenyl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one.
| Compound Name | 7-[2-(2-aminophenyl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one |
|---|---|
| PubChem CID | 159306647 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 7-[2-(2-aminophenyl)acetyl]spiro[2,3-dihydropyrazino[1,2-a]indole-4,1'-cyclobutane]-1-one |
| SMILES | Nc1ccccc1CC(=O)c1ccc2cc3n(c2c1)C1(CCC1)CNC3=O |
| InChI | InChI=1S/C22H21N3O2/c23-17-5-2-1-4-14(17)12-20(26)16-7-6-15-10-19-21(27)24-13-22(8-3-9-22)25(19)18(15)11-16/h1-2,4-7,10-11H,3,8-9,12-13,23H2,(H,24,27) |
| InChIKey | OFXGGNZJBNHINS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|