C22H25F3O4 — CID 159308138
(2S,3R,4R,5R,6S)-2-[4-(1,1-difluoropropyl)-3-(3-fluorophenyl)phenoxy]-5,6-dimethyloxane-3,4-diol (PubChem CID 159308138) has the molecular formula C22H25F3O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[4-(1,1-difluoropropyl)-3-(3-fluorophenyl)phenoxy]-5,6-dimethyloxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[4-(1,1-difluoropropyl)-3-(3-fluorophenyl)phenoxy]-5,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 159308138 |
| Molecular Formula | C22H25F3O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[4-(1,1-difluoropropyl)-3-(3-fluorophenyl)phenoxy]-5,6-dimethyloxane-3,4-diol |
| SMILES | CCC(F)(F)c1ccc(O[C@@H]2O[C@@H](C)[C@H](C)[C@@H](O)[C@H]2O)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H25F3O4/c1-4-22(24,25)18-9-8-16(11-17(18)14-6-5-7-15(23)10-14)29-21-20(27)19(26)12(2)13(3)28-21/h5-13,19-21,26-27H,4H2,1-3H3/t12-,13-,19+,20+,21-/m0/s1 |
| InChIKey | KNVHRWPVTOJHKV-AQJGMREQSA-N |
| XLogP | 4.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |