C23H26F3NO5 — CID 159365092
N-[2-[4-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5,6-dimethyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]-2,2-difluoroethyl]acetamide (PubChem CID 159365092) has the molecular formula C23H26F3NO5 and a molecular weight of 453.46 g/mol. Its IUPAC name is N-[2-[4-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5,6-dimethyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]-2,2-difluoroethyl]acetamide.
| Compound Name | N-[2-[4-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5,6-dimethyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]-2,2-difluoroethyl]acetamide |
|---|---|
| PubChem CID | 159365092 |
| Molecular Formula | C23H26F3NO5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-[4-[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5,6-dimethyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]-2,2-difluoroethyl]acetamide |
| SMILES | CC(=O)NCC(F)(F)c1ccc(O[C@@H]2O[C@@H](C)[C@H](C)[C@@H](O)[C@H]2O)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C23H26F3NO5/c1-12-13(2)31-22(21(30)20(12)29)32-17-7-8-19(23(25,26)11-27-14(3)28)18(10-17)15-5-4-6-16(24)9-15/h4-10,12-13,20-22,29-30H,11H2,1-3H3,(H,27,28)/t12-,13-,20+,21+,22-/m0/s1 |
| InChIKey | LJAHVBHARLHOGB-DSKMESRISA-N |
| XLogP | 3.20 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |