C61H73Br2ClI2N2O2S — CID 159333709
bis(2-bromo-5,10,10-tributyl-7-iodoindeno[1,2-b]indole);4-methylbenzenesulfonyl chloride (PubChem CID 159333709) has the molecular formula C61H73Br2ClI2N2O2S and a molecular weight of 1347.40 g/mol. Its IUPAC name is bis(2-bromo-5,10,10-tributyl-7-iodoindeno[1,2-b]indole);4-methylbenzenesulfonyl chloride.
| Compound Name | bis(2-bromo-5,10,10-tributyl-7-iodoindeno[1,2-b]indole);4-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 159333709 |
| Molecular Formula | C61H73Br2ClI2N2O2S |
| Molecular Weight | 1347.40 g/mol |
| Exact Mass | 1344.15 |
| IUPAC Name | bis(2-bromo-5,10,10-tributyl-7-iodoindeno[1,2-b]indole);4-methylbenzenesulfonyl chloride |
| SMILES | CCCCn1c2c(c3ccc(I)cc31)C(CCCC)(CCCC)c1cc(Br)ccc1-2.CCCCn1c2c(c3ccc(I)cc31)C(CCCC)(CCCC)c1cc(Br)ccc1-2.Cc1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/2C27H33BrIN.C7H7ClO2S/c2*1-4-7-14-27(15-8-5-2)23-17-19(28)10-12-21(23)26-25(27)22-13-11-20(29)18-24(22)30(26)16-9-6-3;1-6-2-4-7(5-3-6)11(8,9)10/h2*10-13,17-18H,4-9,14-16H2,1-3H3;2-5H,1H3 |
| InChIKey | LFGLEADBJDWQOY-UHFFFAOYSA-N |
| XLogP | 20.83 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1347.40 |
| LogP ≤ 5 | 20.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|