About diethylphosphinate
diethylphosphinate (PubChem CID 159335352) has the molecular formula C12H30O6P3-3
and a molecular weight of 363.29 g/mol. Its IUPAC name is diethylphosphinate.
Molecular Properties
| Compound Name | diethylphosphinate |
| PubChem CID | 159335352 |
| Molecular Formula | C12H30O6P3-3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | diethylphosphinate |
| SMILES | CCP(=O)([O-])CC.CCP(=O)([O-])CC.CCP(=O)([O-])CC |
| InChI | InChI=1S/3C4H11O2P/c3*1-3-7(5,6)4-2/h3*3-4H2,1-2H3,(H,5,6)/p-3 |
| InChIKey | LFLQZHRHCMDTIP-UHFFFAOYSA-K |
| XLogP | 1.99 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethylphosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylphosphinate?
The IUPAC name of diethylphosphinate (CID 159335352) is diethylphosphinate.
What is the SMILES notation for diethylphosphinate?
The canonical SMILES for diethylphosphinate is CCP(=O)([O-])CC.CCP(=O)([O-])CC.CCP(=O)([O-])CC.
What is the InChIKey of diethylphosphinate?
The InChIKey is LFLQZHRHCMDTIP-UHFFFAOYSA-K. The full InChI is InChI=1S/3C4H11O2P/c3*1-3-7(5,6)4-2/h3*3-4H2,1-2H3,(H,5,6)/p-3.
What are the key properties of diethylphosphinate?
diethylphosphinate has a molecular weight of 363.29 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethylphosphinate is sourced from PubChem (CID 159335352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).