About aluminum;diethylphosphinate;terephthalate
aluminum;diethylphosphinate;terephthalate (PubChem CID 68742524) has the molecular formula C12H14AlO6P
and a molecular weight of 312.19 g/mol. Its IUPAC name is aluminum;diethylphosphinate;terephthalate.
Molecular Properties
| Compound Name | aluminum;diethylphosphinate;terephthalate |
| PubChem CID | 68742524 |
| Molecular Formula | C12H14AlO6P |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | aluminum;diethylphosphinate;terephthalate |
| SMILES | CCP(=O)([O-])CC.O=C([O-])c1ccc(C(=O)[O-])cc1.[Al+3] |
| InChI | InChI=1S/C8H6O4.C4H11O2P.Al/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-3-7(5,6)4-2;/h1-4H,(H,9,10)(H,11,12);3-4H2,1-2H3,(H,5,6);/q;;+3/p-3 |
| InChIKey | FEZROVYTCNUGNX-UHFFFAOYSA-K |
| XLogP | -1.30 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aluminum;diethylphosphinate;terephthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;diethylphosphinate;terephthalate?
The IUPAC name of aluminum;diethylphosphinate;terephthalate (CID 68742524) is aluminum;diethylphosphinate;terephthalate.
What is the SMILES notation for aluminum;diethylphosphinate;terephthalate?
The canonical SMILES for aluminum;diethylphosphinate;terephthalate is CCP(=O)([O-])CC.O=C([O-])c1ccc(C(=O)[O-])cc1.[Al+3].
What is the InChIKey of aluminum;diethylphosphinate;terephthalate?
The InChIKey is FEZROVYTCNUGNX-UHFFFAOYSA-K. The full InChI is InChI=1S/C8H6O4.C4H11O2P.Al/c9-7(10)5-1-2-6(4-3-5)8(11)12;1-3-7(5,6)4-2;/h1-4H,(H,9,10)(H,11,12);3-4H2,1-2H3,(H,5,6);/q;;+3/p-3.
What are the key properties of aluminum;diethylphosphinate;terephthalate?
aluminum;diethylphosphinate;terephthalate has a molecular weight of 312.19 g/mol, XLogP of -1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;diethylphosphinate;terephthalate is sourced from PubChem (CID 68742524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).