About bis(diethyl(hydroxy)azanium);terephthalate
bis(diethyl(hydroxy)azanium);terephthalate (PubChem CID 139079429) has the molecular formula C16H28N2O6
and a molecular weight of 344.41 g/mol. Its IUPAC name is bis(diethyl(hydroxy)azanium);terephthalate.
Molecular Properties
| Compound Name | bis(diethyl(hydroxy)azanium);terephthalate |
| PubChem CID | 139079429 |
| Molecular Formula | C16H28N2O6 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | bis(diethyl(hydroxy)azanium);terephthalate |
| SMILES | CC[NH+](O)CC.CC[NH+](O)CC.O=C([O-])c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H6O4.2C4H11NO/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-3-5(6)4-2/h1-4H,(H,9,10)(H,11,12);2*6H,3-4H2,1-2H3 |
| InChIKey | HBPZSVKGVSMVNY-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(diethyl(hydroxy)azanium);terephthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diethyl(hydroxy)azanium);terephthalate?
The IUPAC name of bis(diethyl(hydroxy)azanium);terephthalate (CID 139079429) is bis(diethyl(hydroxy)azanium);terephthalate.
What is the SMILES notation for bis(diethyl(hydroxy)azanium);terephthalate?
The canonical SMILES for bis(diethyl(hydroxy)azanium);terephthalate is CC[NH+](O)CC.CC[NH+](O)CC.O=C([O-])c1ccc(C(=O)[O-])cc1.
What is the InChIKey of bis(diethyl(hydroxy)azanium);terephthalate?
The InChIKey is HBPZSVKGVSMVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C4H11NO/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-3-5(6)4-2/h1-4H,(H,9,10)(H,11,12);2*6H,3-4H2,1-2H3.
What are the key properties of bis(diethyl(hydroxy)azanium);terephthalate?
bis(diethyl(hydroxy)azanium);terephthalate has a molecular weight of 344.41 g/mol, XLogP of -2.99, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diethyl(hydroxy)azanium);terephthalate is sourced from PubChem (CID 139079429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).