C19H30Cl2N2O — CID 159335658
(2S,4R)-4-(2-chloroethyl)-N-(2,6-dimethylphenyl)-1-propylpiperidin-1-ium-2-carboxamide chloride (PubChem CID 159335658) has the molecular formula C19H30Cl2N2O and a molecular weight of 373.37 g/mol. Its IUPAC name is (2S,4R)-4-(2-chloroethyl)-N-(2,6-dimethylphenyl)-1-propylpiperidin-1-ium-2-carboxamide chloride.
| Compound Name | (2S,4R)-4-(2-chloroethyl)-N-(2,6-dimethylphenyl)-1-propylpiperidin-1-ium-2-carboxamide chloride |
|---|---|
| PubChem CID | 159335658 |
| Molecular Formula | C19H30Cl2N2O |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2S,4R)-4-(2-chloroethyl)-N-(2,6-dimethylphenyl)-1-propylpiperidin-1-ium-2-carboxamide chloride |
| SMILES | CCC[NH+]1CC[C@@H](CCCl)C[C@H]1C(=O)Nc1c(C)cccc1C.[Cl-] |
| InChI | InChI=1S/C19H29ClN2O.ClH/c1-4-11-22-12-9-16(8-10-20)13-17(22)19(23)21-18-14(2)6-5-7-15(18)3;/h5-7,16-17H,4,8-13H2,1-3H3,(H,21,23);1H/t16-,17+;/m1./s1 |
| InChIKey | LFMPPCNPDMRUIV-PPPUBMIESA-N |
| XLogP | -0.05 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|