C30H52N2O3 — CID 121483382
1-butyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide;dodecanoate (PubChem CID 121483382) has the molecular formula C30H52N2O3 and a molecular weight of 488.76 g/mol. Its IUPAC name is 1-butyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide;dodecanoate.
| Compound Name | 1-butyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide;dodecanoate |
|---|---|
| PubChem CID | 121483382 |
| Molecular Formula | C30H52N2O3 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | 1-butyl-N-(2,6-dimethylphenyl)piperidin-1-ium-2-carboxamide;dodecanoate |
| SMILES | CCCCCCCCCCCC(=O)[O-].CCCC[NH+]1CCCCC1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H28N2O.C12H24O2/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3;1-2-3-4-5-6-7-8-9-10-11-12(13)14/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21);2-11H2,1H3,(H,13,14) |
| InChIKey | WTKIUELJUUUABO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|