C31H53NO3 — CID 159336063
(1R)-2-butyl-N-(2,6-dimethylphenyl)cyclohexane-1-carboxamide;dodecanoic acid (PubChem CID 159336063) has the molecular formula C31H53NO3 and a molecular weight of 487.77 g/mol. Its IUPAC name is (1R)-2-butyl-N-(2,6-dimethylphenyl)cyclohexane-1-carboxamide;dodecanoic acid.
| Compound Name | (1R)-2-butyl-N-(2,6-dimethylphenyl)cyclohexane-1-carboxamide;dodecanoic acid |
|---|---|
| PubChem CID | 159336063 |
| Molecular Formula | C31H53NO3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.40 |
| IUPAC Name | (1R)-2-butyl-N-(2,6-dimethylphenyl)cyclohexane-1-carboxamide;dodecanoic acid |
| SMILES | CCCCC1CCCC[C@H]1C(=O)Nc1c(C)cccc1C.CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H29NO.C12H24O2/c1-4-5-11-16-12-6-7-13-17(16)19(21)20-18-14(2)9-8-10-15(18)3;1-2-3-4-5-6-7-8-9-10-11-12(13)14/h8-10,16-17H,4-7,11-13H2,1-3H3,(H,20,21);2-11H2,1H3,(H,13,14)/t16?,17-;/m1./s1 |
| InChIKey | LFNWTKVVRFPUSN-KOUJAAPTSA-N |
| XLogP | 9.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|