oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate

C19H20O6 — CID 159341467

IUPACoxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate
SMILESO=C(OC1CCCOC1)c1cc(O)c(OCc2ccccc2)c(O)c1
InChIInChI=1S/C19H20O6/c20-16-9-14(19(22)25-15-7-4-8-23-12-15)10-17(21)18(16)24-11-13-5-2-1-3-6-13/h1-3,5-6,9-10,15,20-21H,4,7-8,11-12H2
InChIKeyLGERAWNOFGRYGX-UHFFFAOYSA-N
MW344.36 g/mol
LogP3.01
Rot. Bonds5

About oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate

oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate (PubChem CID 159341467) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate.

Molecular Properties

Compound Nameoxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate
PubChem CID159341467
Molecular FormulaC19H20O6
Molecular Weight344.36 g/mol
Exact Mass344.13
IUPAC Nameoxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate
SMILESO=C(OC1CCCOC1)c1cc(O)c(OCc2ccccc2)c(O)c1
InChIInChI=1S/C19H20O6/c20-16-9-14(19(22)25-15-7-4-8-23-12-15)10-17(21)18(16)24-11-13-5-2-1-3-6-13/h1-3,5-6,9-10,15,20-21H,4,7-8,11-12H2
InChIKeyLGERAWNOFGRYGX-UHFFFAOYSA-N
XLogP3.01
TPSA85.22 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500344.36
LogP ≤ 53.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate?
The IUPAC name of oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate (CID 159341467) is oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate.
What is the SMILES notation for oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate?
The canonical SMILES for oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate is O=C(OC1CCCOC1)c1cc(O)c(OCc2ccccc2)c(O)c1.
What is the InChIKey of oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate?
The InChIKey is LGERAWNOFGRYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O6/c20-16-9-14(19(22)25-15-7-4-8-23-12-15)10-17(21)18(16)24-11-13-5-2-1-3-6-13/h1-3,5-6,9-10,15,20-21H,4,7-8,11-12H2.
What are the key properties of oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate?
oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate has a molecular weight of 344.36 g/mol, XLogP of 3.01, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate is sourced from PubChem (CID 159341467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).