C19H20O6 — CID 159341467
oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate (PubChem CID 159341467) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate.
| Compound Name | oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 159341467 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | oxan-3-yl 3,5-dihydroxy-4-phenylmethoxybenzoate |
| SMILES | O=C(OC1CCCOC1)c1cc(O)c(OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C19H20O6/c20-16-9-14(19(22)25-15-7-4-8-23-12-15)10-17(21)18(16)24-11-13-5-2-1-3-6-13/h1-3,5-6,9-10,15,20-21H,4,7-8,11-12H2 |
| InChIKey | LGERAWNOFGRYGX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |