C14H19N — CID 159341924
3,6-dideuterio-4-methyl-5-(trideuteriomethyl)-2-[1,4,6-trideuterio-5-(trideuteriomethyl)hexa-1,3,5-trien-2-yl]-3,4-dihydropyridine (PubChem CID 159341924) has the molecular formula C14H19N and a molecular weight of 212.38 g/mol. Its IUPAC name is 3,6-dideuterio-4-methyl-5-(trideuteriomethyl)-2-[1,4,6-trideuterio-5-(trideuteriomethyl)hexa-1,3,5-trien-2-yl]-3,4-dihydropyridine.
| Compound Name | 3,6-dideuterio-4-methyl-5-(trideuteriomethyl)-2-[1,4,6-trideuterio-5-(trideuteriomethyl)hexa-1,3,5-trien-2-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 159341924 |
| Molecular Formula | C14H19N |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.22 |
| IUPAC Name | 3,6-dideuterio-4-methyl-5-(trideuteriomethyl)-2-[1,4,6-trideuterio-5-(trideuteriomethyl)hexa-1,3,5-trien-2-yl]-3,4-dihydropyridine |
| SMILES | [2H]/C=C(\C=C([2H])/C(=C/[2H])C([2H])([2H])[2H])C1=NC([2H])=C(C([2H])([2H])[2H])C(C)C1[2H] |
| InChI | InChI=1S/C14H19N/c1-10(2)6-7-11(3)14-8-12(4)13(5)9-15-14/h6-7,9,12H,1,3,8H2,2,4-5H3/i1D,2D3,3D,5D3,6D,8D,9D/b7-6?,10-1+,11-3+ |
| InChIKey | DYNYWAGRQWLFCD-OASNPONJSA-N |
| XLogP | 4.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|