C29H39NO6 — CID 159344189
methyl 4-[2-[4-(4-butan-2-ylphenyl)-4-oxobutoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate (PubChem CID 159344189) has the molecular formula C29H39NO6 and a molecular weight of 497.63 g/mol. Its IUPAC name is methyl 4-[2-[4-(4-butan-2-ylphenyl)-4-oxobutoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate.
| Compound Name | methyl 4-[2-[4-(4-butan-2-ylphenyl)-4-oxobutoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 159344189 |
| Molecular Formula | C29H39NO6 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | methyl 4-[2-[4-(4-butan-2-ylphenyl)-4-oxobutoxy]ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoate |
| SMILES | CCC(C)c1ccc(C(=O)CCCOCCN(C(=O)OC(C)(C)C)c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C29H39NO6/c1-7-21(2)22-10-12-23(13-11-22)26(31)9-8-19-35-20-18-30(28(33)36-29(3,4)5)25-16-14-24(15-17-25)27(32)34-6/h10-17,21H,7-9,18-20H2,1-6H3 |
| InChIKey | ZKLJINZPXVRVNI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|