C31H32N2O4 — CID 159349083
2-amino-N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]phenyl]propanamide (PubChem CID 159349083) has the molecular formula C31H32N2O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is 2-amino-N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]phenyl]propanamide.
| Compound Name | 2-amino-N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 159349083 |
| Molecular Formula | C31H32N2O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 2-amino-N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]phenyl]propanamide |
| SMILES | COc1ccc(C(OCc2ccc(NC(=O)C(C)N)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H32N2O4/c1-22(32)30(34)33-27-15-9-23(10-16-27)21-37-31(24-7-5-4-6-8-24,25-11-17-28(35-2)18-12-25)26-13-19-29(36-3)20-14-26/h4-20,22H,21,32H2,1-3H3,(H,33,34) |
| InChIKey | NPJSXQLTBIOCBY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|