C18H27N3O4 — CID 159358280
tert-butyl N-[amino-[2-(2,4,6-trimethylphenoxy)propanoylamino]methylidene]carbamate (PubChem CID 159358280) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is tert-butyl N-[amino-[2-(2,4,6-trimethylphenoxy)propanoylamino]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[2-(2,4,6-trimethylphenoxy)propanoylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 159358280 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl N-[amino-[2-(2,4,6-trimethylphenoxy)propanoylamino]methylidene]carbamate |
| SMILES | Cc1cc(C)c(OC(C)C(=O)NC(N)=NC(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C18H27N3O4/c1-10-8-11(2)14(12(3)9-10)24-13(4)15(22)20-16(19)21-17(23)25-18(5,6)7/h8-9,13H,1-7H3,(H3,19,20,21,22,23) |
| InChIKey | UWJPKKHROLEFLY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|