About butyl acetate;furan
butyl acetate;furan (PubChem CID 159363769) has the molecular formula C10H16O3
and a molecular weight of 184.24 g/mol. Its IUPAC name is butyl acetate;furan.
Molecular Properties
| Compound Name | butyl acetate;furan |
| PubChem CID | 159363769 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | butyl acetate;furan |
| SMILES | CCCCOC(C)=O.c1ccoc1 |
| InChI | InChI=1S/C6H12O2.C4H4O/c1-3-4-5-8-6(2)7;1-2-4-5-3-1/h3-5H2,1-2H3;1-4H |
| InChIKey | LIWDJIDGIMICJH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl acetate;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl acetate;furan?
The IUPAC name of butyl acetate;furan (CID 159363769) is butyl acetate;furan.
What is the SMILES notation for butyl acetate;furan?
The canonical SMILES for butyl acetate;furan is CCCCOC(C)=O.c1ccoc1.
What is the InChIKey of butyl acetate;furan?
The InChIKey is LIWDJIDGIMICJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H4O/c1-3-4-5-8-6(2)7;1-2-4-5-3-1/h3-5H2,1-2H3;1-4H.
What are the key properties of butyl acetate;furan?
butyl acetate;furan has a molecular weight of 184.24 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl acetate;furan is sourced from PubChem (CID 159363769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).