C33H28O10 — CID 159365506
5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-2,3,7,10-tetrol;3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene (PubChem CID 159365506) has the molecular formula C33H28O10 and a molecular weight of 584.58 g/mol. Its IUPAC name is 5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-2,3,7,10-tetrol;3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene.
| Compound Name | 5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-2,3,7,10-tetrol;3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene |
|---|---|
| PubChem CID | 159365506 |
| Molecular Formula | C33H28O10 |
| Molecular Weight | 584.58 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 5,6a,7,12a-tetrahydroisochromeno[4,3-b]chromene-2,3,7,10-tetrol;3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene |
| SMILES | COc1ccc2c(c1)OCc1c-2oc2cc(OC)ccc12.Oc1ccc2c(c1)OC1c3cc(O)c(O)cc3COC1C2O |
| InChI | InChI=1S/C17H14O4.C16H14O6/c1-18-10-4-6-13-15(7-10)20-9-14-12-5-3-11(19-2)8-16(12)21-17(13)14;17-8-1-2-9-13(4-8)22-15-10-5-12(19)11(18)3-7(10)6-21-16(15)14(9)20/h3-8H,9H2,1-2H3;1-5,14-20H,6H2 |
| InChIKey | LJBQWZLKTOLYLA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|