C17H14O4 — CID 624785
3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene (PubChem CID 624785) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene.
| Compound Name | 3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene |
|---|---|
| PubChem CID | 624785 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3,9-dimethoxy-6H-[1]benzofuro[3,2-c]chromene |
| SMILES | COc1ccc2c(c1)OCc1c-2oc2cc(OC)ccc12 |
| InChI | InChI=1S/C17H14O4/c1-18-10-4-6-13-15(7-10)20-9-14-12-5-3-11(19-2)8-16(12)21-17(13)14/h3-8H,9H2,1-2H3 |
| InChIKey | FLEXCYTURSFUNC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |