C19H16O6 — CID 163070448
2,3,10-trimethoxy-5H-isochromeno[4,3-b]chromen-7-one (PubChem CID 163070448) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2,3,10-trimethoxy-5H-isochromeno[4,3-b]chromen-7-one.
| Compound Name | 2,3,10-trimethoxy-5H-isochromeno[4,3-b]chromen-7-one |
|---|---|
| PubChem CID | 163070448 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,3,10-trimethoxy-5H-isochromeno[4,3-b]chromen-7-one |
| SMILES | COc1ccc2c(=O)c3c(oc2c1)-c1cc(OC)c(OC)cc1CO3 |
| InChI | InChI=1S/C19H16O6/c1-21-11-4-5-12-14(7-11)25-18-13-8-16(23-3)15(22-2)6-10(13)9-24-19(18)17(12)20/h4-8H,9H2,1-3H3 |
| InChIKey | NGRSXQOQVOCEGD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |