C22H38N4O5 — CID 159370247
(2,5-dioxopyrrolidin-1-yl) 6-[[2-[1,4-bis(dideuteriomethyl)-3,5-dimethylpiperazin-2-yl]-2-methylpropanoyl]amino]hexanoate (PubChem CID 159370247) has the molecular formula C22H38N4O5 and a molecular weight of 442.59 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[2-[1,4-bis(dideuteriomethyl)-3,5-dimethylpiperazin-2-yl]-2-methylpropanoyl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-[1,4-bis(dideuteriomethyl)-3,5-dimethylpiperazin-2-yl]-2-methylpropanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 159370247 |
| Molecular Formula | C22H38N4O5 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[2-[1,4-bis(dideuteriomethyl)-3,5-dimethylpiperazin-2-yl]-2-methylpropanoyl]amino]hexanoate |
| SMILES | [2H]C([2H])N1CC(C)N(C([2H])[2H])C(C)C1C(C)(C)C(=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C22H38N4O5/c1-15-14-24(5)20(16(2)25(15)6)22(3,4)21(30)23-13-9-7-8-10-19(29)31-26-17(27)11-12-18(26)28/h15-16,20H,7-14H2,1-6H3,(H,23,30)/i5D2,6D2 |
| InChIKey | LDPJGMXUWQXMLV-NZLXMSDQSA-N |
| XLogP | 1.32 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|