C33H35N — CID 159371955
N-[2-(2-deuteriopropan-2-yl)-3-phenylphenyl]-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-9,9-dimethylfluoren-2-amine (PubChem CID 159371955) has the molecular formula C33H35N and a molecular weight of 453.70 g/mol. Its IUPAC name is N-[2-(2-deuteriopropan-2-yl)-3-phenylphenyl]-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-9,9-dimethylfluoren-2-amine.
| Compound Name | N-[2-(2-deuteriopropan-2-yl)-3-phenylphenyl]-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 159371955 |
| Molecular Formula | C33H35N |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.33 |
| IUPAC Name | N-[2-(2-deuteriopropan-2-yl)-3-phenylphenyl]-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-9,9-dimethylfluoren-2-amine |
| SMILES | [2H]C(C)(C)c1c(Nc2cc3c(cc2C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])-c2ccccc2C3(C)C)cccc1-c1ccccc1 |
| InChI | InChI=1S/C33H35N/c1-21(2)26-19-27-25-15-10-11-17-28(25)33(5,6)29(27)20-31(26)34-30-18-12-16-24(32(30)22(3)4)23-13-8-7-9-14-23/h7-22,34H,1-6H3/i1D3,2D3,21D,22D |
| InChIKey | KRVSQYXIJASOSG-CJGJEOQPSA-N |
| XLogP | 9.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |