C8H23N6O2- — CID 159379820
[2-aminoethyl(ethyl)amino]-oxido-oxidoiminoazanium;N'-ethylethane-1,2-diamine (PubChem CID 159379820) has the molecular formula C8H23N6O2- and a molecular weight of 235.31 g/mol. Its IUPAC name is [2-aminoethyl(ethyl)amino]-oxido-oxidoiminoazanium;N'-ethylethane-1,2-diamine.
| Compound Name | [2-aminoethyl(ethyl)amino]-oxido-oxidoiminoazanium;N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 159379820 |
| Molecular Formula | C8H23N6O2- |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | [2-aminoethyl(ethyl)amino]-oxido-oxidoiminoazanium;N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)[N+]([O-])=N[O-].CCNCCN |
| InChI | InChI=1S/C4H12N4O2.C4H12N2/c1-2-7(4-3-5)8(10)6-9;1-2-6-4-3-5/h9H,2-5H2,1H3;6H,2-5H2,1H3/p-1 |
| InChIKey | BSUZUPSNKYRJFD-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|