C31H35F3N2O — CID 159389903
N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide (PubChem CID 159389903) has the molecular formula C31H35F3N2O and a molecular weight of 508.63 g/mol. Its IUPAC name is N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide.
| Compound Name | N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 159389903 |
| Molecular Formula | C31H35F3N2O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-[(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-6-yl]-N-(2-methylpropyl)-3-[4-(trifluoromethyl)phenyl]prop-2-ynamide |
| SMILES | CC(C)CN(C(=O)C#Cc1ccc(C(F)(F)F)cc1)c1cccc2c1C[C@@H]1[C@@H]3CCCC[C@]23CCN1C |
| InChI | InChI=1S/C31H35F3N2O/c1-21(2)20-36(29(37)15-12-22-10-13-23(14-11-22)31(32,33)34)27-9-6-8-25-24(27)19-28-26-7-4-5-16-30(25,26)17-18-35(28)3/h6,8-11,13-14,21,26,28H,4-5,7,16-20H2,1-3H3/t26-,28+,30-/m0/s1 |
| InChIKey | LLZBCHBMQRGENM-ZFOGOZASSA-N |
| XLogP | 6.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|