C10H16O3 — CID 15939131
2-[[(3aR,6aR)-3a-methyl-3,6-dihydro-2H-cyclopenta[b]furan-6a-yl]oxy]ethanol (PubChem CID 15939131) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-[[(3aR,6aR)-3a-methyl-3,6-dihydro-2H-cyclopenta[b]furan-6a-yl]oxy]ethanol.
| Compound Name | 2-[[(3aR,6aR)-3a-methyl-3,6-dihydro-2H-cyclopenta[b]furan-6a-yl]oxy]ethanol |
|---|---|
| PubChem CID | 15939131 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[[(3aR,6aR)-3a-methyl-3,6-dihydro-2H-cyclopenta[b]furan-6a-yl]oxy]ethanol |
| SMILES | C[C@@]12C=CC[C@]1(OCCO)OCC2 |
| InChI | InChI=1S/C10H16O3/c1-9-3-2-4-10(9,12-7-5-9)13-8-6-11/h2-3,11H,4-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | GQSTVVYGUVJDOR-VHSXEESVSA-N |
| XLogP | 1.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|