C31H29Cl2F2N3O6 — CID 159392790
4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(3-fluoro-2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]oxy-3-methoxybenzoic acid (PubChem CID 159392790) has the molecular formula C31H29Cl2F2N3O6 and a molecular weight of 648.49 g/mol. Its IUPAC name is 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(3-fluoro-2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]oxy-3-methoxybenzoic acid.
| Compound Name | 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(3-fluoro-2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]oxy-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 159392790 |
| Molecular Formula | C31H29Cl2F2N3O6 |
| Molecular Weight | 648.49 g/mol |
| Exact Mass | 647.14 |
| IUPAC Name | 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(3-fluoro-2,2-dimethylpropyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]oxy-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1ONC(=O)[C@@H]1N[C@@H](CC(C)(C)CF)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C31H29Cl2F2N3O6/c1-30(2,14-34)13-23-31(18-9-8-16(32)12-20(18)36-29(31)42)24(17-5-4-6-19(33)25(17)35)26(37-23)27(39)38-44-21-10-7-15(28(40)41)11-22(21)43-3/h4-12,23-24,26,37H,13-14H2,1-3H3,(H,36,42)(H,38,39)(H,40,41)/t23-,24-,26+,31+/m0/s1 |
| InChIKey | LMIHMRHDWDNPQV-ISKXDESKSA-N |
| XLogP | 5.65 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|