C30H26Cl2FN3O5 — CID 118496706
4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid (PubChem CID 118496706) has the molecular formula C30H26Cl2FN3O5 and a molecular weight of 598.46 g/mol. Its IUPAC name is 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 118496706 |
| Molecular Formula | C30H26Cl2FN3O5 |
| Molecular Weight | 598.46 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NC(=O)[C@@H]1N[C@@H](C=C(C)C)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C30H26Cl2FN3O5/c1-14(2)11-23-30(18-9-8-16(31)13-21(18)35-29(30)40)24(17-5-4-6-19(32)25(17)33)26(36-23)27(37)34-20-10-7-15(28(38)39)12-22(20)41-3/h4-13,23-24,26,36H,1-3H3,(H,34,37)(H,35,40)(H,38,39)/t23-,24-,26+,30+/m0/s1 |
| InChIKey | FNUFSFPCNRFPDL-HLNVOFQHSA-N |
| XLogP | 5.76 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|