C32H30Cl2FN3O5 — CID 118496728
ethyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate (PubChem CID 118496728) has the molecular formula C32H30Cl2FN3O5 and a molecular weight of 626.51 g/mol. Its IUPAC name is ethyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate.
| Compound Name | ethyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 118496728 |
| Molecular Formula | C32H30Cl2FN3O5 |
| Molecular Weight | 626.51 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | ethyl 4-[[(2'R,3R,3'S,5'S)-6-chloro-3'-(3-chloro-2-fluorophenyl)-5'-(2-methylprop-1-enyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carbonyl]amino]-3-methoxybenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](C=C(C)C)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)c(OC)c1 |
| InChI | InChI=1S/C32H30Cl2FN3O5/c1-5-43-30(40)17-9-12-22(24(14-17)42-4)36-29(39)28-26(19-7-6-8-21(34)27(19)35)32(25(38-28)13-16(2)3)20-11-10-18(33)15-23(20)37-31(32)41/h6-15,25-26,28,38H,5H2,1-4H3,(H,36,39)(H,37,41)/t25-,26-,28+,32+/m0/s1 |
| InChIKey | ILJVLGQGAZYZRG-CKHSQSCFSA-N |
| XLogP | 6.24 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|