C27H36N2O5S — CID 15940643
8-[(4-butoxyphenyl)methylsulfonyl]-3-[(3,5-dimethylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 15940643) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol. Its IUPAC name is 8-[(4-butoxyphenyl)methylsulfonyl]-3-[(3,5-dimethylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[(4-butoxyphenyl)methylsulfonyl]-3-[(3,5-dimethylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 15940643 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 8-[(4-butoxyphenyl)methylsulfonyl]-3-[(3,5-dimethylphenyl)methyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | CCCCOc1ccc(CS(=O)(=O)N2CCC3(CC2)CN(Cc2cc(C)cc(C)c2)C(=O)O3)cc1 |
| InChI | InChI=1S/C27H36N2O5S/c1-4-5-14-33-25-8-6-23(7-9-25)19-35(31,32)29-12-10-27(11-13-29)20-28(26(30)34-27)18-24-16-21(2)15-22(3)17-24/h6-9,15-17H,4-5,10-14,18-20H2,1-3H3 |
| InChIKey | BGGPEGFXQJCKJE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|