C20H17Br — CID 159406823
5-bromo-7,7-dimethyl-12H-benzo[a]anthracene (PubChem CID 159406823) has the molecular formula C20H17Br and a molecular weight of 337.26 g/mol. Its IUPAC name is 5-bromo-7,7-dimethyl-12H-benzo[a]anthracene.
| Compound Name | 5-bromo-7,7-dimethyl-12H-benzo[a]anthracene |
|---|---|
| PubChem CID | 159406823 |
| Molecular Formula | C20H17Br |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-bromo-7,7-dimethyl-12H-benzo[a]anthracene |
| SMILES | CC1(C)c2ccccc2Cc2c1cc(Br)c1ccccc21 |
| InChI | InChI=1S/C20H17Br/c1-20(2)17-10-6-3-7-13(17)11-16-14-8-4-5-9-15(14)19(21)12-18(16)20/h3-10,12H,11H2,1-2H3 |
| InChIKey | LOBIWDFXZYZHFR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |