About 1,3-dimethylcyclohexane;2-isocyanatopropane
1,3-dimethylcyclohexane;2-isocyanatopropane (PubChem CID 159407398) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 1,3-dimethylcyclohexane;2-isocyanatopropane.
Molecular Properties
| Compound Name | 1,3-dimethylcyclohexane;2-isocyanatopropane |
| PubChem CID | 159407398 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1,3-dimethylcyclohexane;2-isocyanatopropane |
| SMILES | CC(C)N=C=O.CC1CCCC(C)C1 |
| InChI | InChI=1S/C8H16.C4H7NO/c1-7-4-3-5-8(2)6-7;1-4(2)5-3-6/h7-8H,3-6H2,1-2H3;4H,1-2H3 |
| InChIKey | LODCOVRQADNKQW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylcyclohexane;2-isocyanatopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylcyclohexane;2-isocyanatopropane?
The IUPAC name of 1,3-dimethylcyclohexane;2-isocyanatopropane (CID 159407398) is 1,3-dimethylcyclohexane;2-isocyanatopropane.
What is the SMILES notation for 1,3-dimethylcyclohexane;2-isocyanatopropane?
The canonical SMILES for 1,3-dimethylcyclohexane;2-isocyanatopropane is CC(C)N=C=O.CC1CCCC(C)C1.
What is the InChIKey of 1,3-dimethylcyclohexane;2-isocyanatopropane?
The InChIKey is LODCOVRQADNKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.C4H7NO/c1-7-4-3-5-8(2)6-7;1-4(2)5-3-6/h7-8H,3-6H2,1-2H3;4H,1-2H3.
What are the key properties of 1,3-dimethylcyclohexane;2-isocyanatopropane?
1,3-dimethylcyclohexane;2-isocyanatopropane has a molecular weight of 197.32 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylcyclohexane;2-isocyanatopropane is sourced from PubChem (CID 159407398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).