C12H23NO — CID 159407398
1,3-dimethylcyclohexane;2-isocyanatopropane (PubChem CID 159407398) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1,3-dimethylcyclohexane;2-isocyanatopropane.
| Compound Name | 1,3-dimethylcyclohexane;2-isocyanatopropane |
|---|---|
| PubChem CID | 159407398 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1,3-dimethylcyclohexane;2-isocyanatopropane |
| SMILES | CC(C)N=C=O.CC1CCCC(C)C1 |
| InChI | InChI=1S/C8H16.C4H7NO/c1-7-4-3-5-8(2)6-7;1-4(2)5-3-6/h7-8H,3-6H2,1-2H3;4H,1-2H3 |
| InChIKey | LODCOVRQADNKQW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|