About methane;3-(methylamino)butanoate
methane;3-(methylamino)butanoate (PubChem CID 159407582) has the molecular formula C6H14NO2-
and a molecular weight of 132.18 g/mol. Its IUPAC name is methane;3-(methylamino)butanoate.
Molecular Properties
| Compound Name | methane;3-(methylamino)butanoate |
| PubChem CID | 159407582 |
| Molecular Formula | C6H14NO2- |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | methane;3-(methylamino)butanoate |
| SMILES | C.CNC(C)CC(=O)[O-] |
| InChI | InChI=1S/C5H11NO2.CH4/c1-4(6-2)3-5(7)8;/h4,6H,3H2,1-2H3,(H,7,8);1H4/p-1 |
| InChIKey | LODTXIDDFLEOMS-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;3-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-(methylamino)butanoate?
The IUPAC name of methane;3-(methylamino)butanoate (CID 159407582) is methane;3-(methylamino)butanoate.
What is the SMILES notation for methane;3-(methylamino)butanoate?
The canonical SMILES for methane;3-(methylamino)butanoate is C.CNC(C)CC(=O)[O-].
What is the InChIKey of methane;3-(methylamino)butanoate?
The InChIKey is LODTXIDDFLEOMS-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11NO2.CH4/c1-4(6-2)3-5(7)8;/h4,6H,3H2,1-2H3,(H,7,8);1H4/p-1.
What are the key properties of methane;3-(methylamino)butanoate?
methane;3-(methylamino)butanoate has a molecular weight of 132.18 g/mol, XLogP of -0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-(methylamino)butanoate is sourced from PubChem (CID 159407582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).