About 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane
2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane (PubChem CID 159416150) has the molecular formula C19H40N2O2S
and a molecular weight of 360.61 g/mol. Its IUPAC name is 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane.
Molecular Properties
| Compound Name | 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane |
| PubChem CID | 159416150 |
| Molecular Formula | C19H40N2O2S |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane |
| SMILES | C.CC(C)(C)N1CC2(CCC2)C1.CC(C)(C)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H19N.C8H17NO2S.CH4/c1-9(2,3)11-7-10(8-11)5-4-6-10;1-8(2,3)9-4-6-12(10,11)7-5-9;/h4-8H2,1-3H3;4-7H2,1-3H3;1H4 |
| InChIKey | LPEMJRYKOBGEHR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane?
The IUPAC name of 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane (CID 159416150) is 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane.
What is the SMILES notation for 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane?
The canonical SMILES for 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane is C.CC(C)(C)N1CC2(CCC2)C1.CC(C)(C)N1CCS(=O)(=O)CC1.
What is the InChIKey of 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane?
The InChIKey is LPEMJRYKOBGEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.C8H17NO2S.CH4/c1-9(2,3)11-7-10(8-11)5-4-6-10;1-8(2,3)9-4-6-12(10,11)7-5-9;/h4-8H2,1-3H3;4-7H2,1-3H3;1H4.
What are the key properties of 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane?
2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane has a molecular weight of 360.61 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2-azaspiro[3.3]heptane;4-tert-butyl-1,4-thiazinane 1,1-dioxide;methane is sourced from PubChem (CID 159416150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).