C22H11N4O+ — CID 159418747
20,21-diisocyano-3-oxa-23-aza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4,6,8,11,15,17(22),18,20-decaene (PubChem CID 159418747) has the molecular formula C22H11N4O+ and a molecular weight of 347.36 g/mol. Its IUPAC name is 20,21-diisocyano-3-oxa-23-aza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4,6,8,11,15,17(22),18,20-decaene.
| Compound Name | 20,21-diisocyano-3-oxa-23-aza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4,6,8,11,15,17(22),18,20-decaene |
|---|---|
| PubChem CID | 159418747 |
| Molecular Formula | C22H11N4O+ |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 20,21-diisocyano-3-oxa-23-aza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4,6,8,11,15,17(22),18,20-decaene |
| SMILES | [C-]#[N+]c1ccc2c[n+]3n(c2c1[N+]#[C-])-c1c(ccc2c1oc1ccccc12)C3 |
| InChI | InChI=1S/C22H11N4O/c1-23-17-10-8-13-11-25-12-14-7-9-16-15-5-3-4-6-18(15)27-22(16)21(14)26(25)20(13)19(17)24-2/h3-11H,12H2/q+1 |
| InChIKey | JIJVCDVSIWSYFM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 30.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|