C22H11N4O+ — CID 157114116
16-isocyano-10-oxa-14-aza-22-azoniahexacyclo[11.10.0.03,11.04,9.014,22.015,20]tricosa-1,3(11),4,6,8,12,15,17,19,21-decaene-19-carbonitrile (PubChem CID 157114116) has the molecular formula C22H11N4O+ and a molecular weight of 347.36 g/mol. Its IUPAC name is 16-isocyano-10-oxa-14-aza-22-azoniahexacyclo[11.10.0.03,11.04,9.014,22.015,20]tricosa-1,3(11),4,6,8,12,15,17,19,21-decaene-19-carbonitrile.
| Compound Name | 16-isocyano-10-oxa-14-aza-22-azoniahexacyclo[11.10.0.03,11.04,9.014,22.015,20]tricosa-1,3(11),4,6,8,12,15,17,19,21-decaene-19-carbonitrile |
|---|---|
| PubChem CID | 157114116 |
| Molecular Formula | C22H11N4O+ |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 16-isocyano-10-oxa-14-aza-22-azoniahexacyclo[11.10.0.03,11.04,9.014,22.015,20]tricosa-1,3(11),4,6,8,12,15,17,19,21-decaene-19-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(C#N)c2c[n+]3n(c12)-c1cc2oc4ccccc4c2cc1C3 |
| InChI | InChI=1S/C22H11N4O/c1-24-18-7-6-13(10-23)17-12-25-11-14-8-16-15-4-2-3-5-20(15)27-21(16)9-19(14)26(25)22(17)18/h2-9,12H,11H2/q+1 |
| InChIKey | IODCTRMZWKRYSV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|