C22H13N4+ — CID 158195011
2-isocyano-6-phenyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile (PubChem CID 158195011) has the molecular formula C22H13N4+ and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-isocyano-6-phenyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile.
| Compound Name | 2-isocyano-6-phenyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile |
|---|---|
| PubChem CID | 158195011 |
| Molecular Formula | C22H13N4+ |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-isocyano-6-phenyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c[n+]3n2-c2c(cccc2-c2ccccc2)C3)c1C#N |
| InChI | InChI=1S/C22H13N4/c1-24-20-10-11-21-19(18(20)12-23)14-25-13-16-8-5-9-17(22(16)26(21)25)15-6-3-2-4-7-15/h2-11,14H,13H2/q+1 |
| InChIKey | WPDBJZYHCUTPBQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|