C19H15N4+ — CID 157418577
2-isocyano-6,7,8-trimethyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile (PubChem CID 157418577) has the molecular formula C19H15N4+ and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-isocyano-6,7,8-trimethyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile.
| Compound Name | 2-isocyano-6,7,8-trimethyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile |
|---|---|
| PubChem CID | 157418577 |
| Molecular Formula | C19H15N4+ |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-isocyano-6,7,8-trimethyl-10H-indazolo[1,2-a]indazol-11-ium-1-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c[n+]3n2-c2c(cc(C)c(C)c2C)C3)c1C#N |
| InChI | InChI=1S/C19H15N4/c1-11-7-14-9-22-10-16-15(8-20)17(21-4)5-6-18(16)23(22)19(14)13(3)12(11)2/h5-7,10H,9H2,1-3H3/q+1 |
| InChIKey | OLBJSFYLODAMOC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|