C21H10N5O+ — CID 159131578
19,20-diisocyano-3-oxa-5,23-diaza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4(9),5,7,11,15,17,19,21-decaene (PubChem CID 159131578) has the molecular formula C21H10N5O+ and a molecular weight of 348.35 g/mol. Its IUPAC name is 19,20-diisocyano-3-oxa-5,23-diaza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4(9),5,7,11,15,17,19,21-decaene.
| Compound Name | 19,20-diisocyano-3-oxa-5,23-diaza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4(9),5,7,11,15,17,19,21-decaene |
|---|---|
| PubChem CID | 159131578 |
| Molecular Formula | C21H10N5O+ |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 19,20-diisocyano-3-oxa-5,23-diaza-15-azoniahexacyclo[11.10.0.02,10.04,9.015,23.017,22]tricosa-1(13),2(10),4(9),5,7,11,15,17,19,21-decaene |
| SMILES | [C-]#[N+]c1cc2c[n+]3n(c2cc1[N+]#[C-])-c1c(ccc2c1oc1ncccc12)C3 |
| InChI | InChI=1S/C21H10N5O/c1-22-16-8-13-11-25-10-12-5-6-14-15-4-3-7-24-21(15)27-20(14)19(12)26(25)18(13)9-17(16)23-2/h3-9,11H,10H2/q+1 |
| InChIKey | PRMOAKILNSZRKT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|