C16H28F8O12S4 — CID 159420325
4-(1,1-difluoroethylsulfonyloxy)butyl 1,1-difluoroethanesulfonate;4-(1,2-difluoroethylsulfonyloxy)butyl 1,2-difluoroethanesulfonate (PubChem CID 159420325) has the molecular formula C16H28F8O12S4 and a molecular weight of 692.64 g/mol. Its IUPAC name is 4-(1,1-difluoroethylsulfonyloxy)butyl 1,1-difluoroethanesulfonate;4-(1,2-difluoroethylsulfonyloxy)butyl 1,2-difluoroethanesulfonate.
| Compound Name | 4-(1,1-difluoroethylsulfonyloxy)butyl 1,1-difluoroethanesulfonate;4-(1,2-difluoroethylsulfonyloxy)butyl 1,2-difluoroethanesulfonate |
|---|---|
| PubChem CID | 159420325 |
| Molecular Formula | C16H28F8O12S4 |
| Molecular Weight | 692.64 g/mol |
| Exact Mass | 692.03 |
| IUPAC Name | 4-(1,1-difluoroethylsulfonyloxy)butyl 1,1-difluoroethanesulfonate;4-(1,2-difluoroethylsulfonyloxy)butyl 1,2-difluoroethanesulfonate |
| SMILES | CC(F)(F)S(=O)(=O)OCCCCOS(=O)(=O)C(C)(F)F.O=S(=O)(OCCCCOS(=O)(=O)C(F)CF)C(F)CF |
| InChI | InChI=1S/2C8H14F4O6S2/c1-7(9,10)19(13,14)17-5-3-4-6-18-20(15,16)8(2,11)12;9-5-7(11)19(13,14)17-3-1-2-4-18-20(15,16)8(12)6-10/h3-6H2,1-2H3;7-8H,1-6H2 |
| InChIKey | LPRMUROOLFHBQY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 173.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|