C33H46O6 — CID 159422560
[(3R,3aR,6S,6aS)-6-(4-hexylbenzoyl)oxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] 4-hexylbenzoate;methane (PubChem CID 159422560) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-6-(4-hexylbenzoyl)oxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] 4-hexylbenzoate;methane.
| Compound Name | [(3R,3aR,6S,6aS)-6-(4-hexylbenzoyl)oxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] 4-hexylbenzoate;methane |
|---|---|
| PubChem CID | 159422560 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [(3R,3aR,6S,6aS)-6-(4-hexylbenzoyl)oxy-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan-3-yl] 4-hexylbenzoate;methane |
| SMILES | C.CCCCCCc1ccc(C(=O)O[C@@H]2OC[C@H]3[C@@H]2OC[C@@H]3OC(=O)c2ccc(CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C32H42O6.CH4/c1-3-5-7-9-11-23-13-17-25(18-14-23)30(33)37-28-22-35-29-27(28)21-36-32(29)38-31(34)26-19-15-24(16-20-26)12-10-8-6-4-2;/h13-20,27-29,32H,3-12,21-22H2,1-2H3;1H4/t27-,28+,29+,32+;/m1./s1 |
| InChIKey | LPYGQHIJWLJLIG-PUWYRZKLSA-N |
| XLogP | 7.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|