C50H62N4O6 — CID 67129481
[6-[4-[4-(4-pentylphenyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[4-(4-pentylphenyl)piperazin-1-yl]benzoate (PubChem CID 67129481) has the molecular formula C50H62N4O6 and a molecular weight of 815.07 g/mol. Its IUPAC name is [6-[4-[4-(4-pentylphenyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[4-(4-pentylphenyl)piperazin-1-yl]benzoate.
| Compound Name | [6-[4-[4-(4-pentylphenyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[4-(4-pentylphenyl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 67129481 |
| Molecular Formula | C50H62N4O6 |
| Molecular Weight | 815.07 g/mol |
| Exact Mass | 814.47 |
| IUPAC Name | [6-[4-[4-(4-pentylphenyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-[4-(4-pentylphenyl)piperazin-1-yl]benzoate |
| SMILES | CCCCCc1ccc(N2CCN(c3ccc(C(=O)OC4COC5C(OC(=O)c6ccc(N7CCN(c8ccc(CCCCC)cc8)CC7)cc6)COC45)cc3)CC2)cc1 |
| InChI | InChI=1S/C50H62N4O6/c1-3-5-7-9-37-11-19-41(20-12-37)51-27-31-53(32-28-51)43-23-15-39(16-24-43)49(55)59-45-35-57-48-46(36-58-47(45)48)60-50(56)40-17-25-44(26-18-40)54-33-29-52(30-34-54)42-21-13-38(14-22-42)10-8-6-4-2/h11-26,45-48H,3-10,27-36H2,1-2H3 |
| InChIKey | NWWWNAQYSBEUEH-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.07 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|